C10H11F5O4 — CID 139842370
4-O-(1,1,2,2,2-pentafluoroethyl) 1-O-propan-2-yl 2-methylidenebutanedioate (PubChem CID 139842370) has the molecular formula C10H11F5O4 and a molecular weight of 290.18 g/mol. Its IUPAC name is 4-O-(1,1,2,2,2-pentafluoroethyl) 1-O-propan-2-yl 2-methylidenebutanedioate.
| Compound Name | 4-O-(1,1,2,2,2-pentafluoroethyl) 1-O-propan-2-yl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 139842370 |
| Molecular Formula | C10H11F5O4 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-O-(1,1,2,2,2-pentafluoroethyl) 1-O-propan-2-yl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(F)(F)C(F)(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C10H11F5O4/c1-5(2)18-8(17)6(3)4-7(16)19-10(14,15)9(11,12)13/h5H,3-4H2,1-2H3 |
| InChIKey | DKOPPPOADUFVPE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|