C16H14Cl3F3O4 — CID 167462530
4-O-(2,2,2-trichloroethyl) 1-O-[1-[4-(trifluoromethyl)phenyl]ethyl] 2-methylidenebutanedioate (PubChem CID 167462530) has the molecular formula C16H14Cl3F3O4 and a molecular weight of 433.64 g/mol. Its IUPAC name is 4-O-(2,2,2-trichloroethyl) 1-O-[1-[4-(trifluoromethyl)phenyl]ethyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-(2,2,2-trichloroethyl) 1-O-[1-[4-(trifluoromethyl)phenyl]ethyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 167462530 |
| Molecular Formula | C16H14Cl3F3O4 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 4-O-(2,2,2-trichloroethyl) 1-O-[1-[4-(trifluoromethyl)phenyl]ethyl] 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCC(Cl)(Cl)Cl)C(=O)OC(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14Cl3F3O4/c1-9(7-13(23)25-8-15(17,18)19)14(24)26-10(2)11-3-5-12(6-4-11)16(20,21)22/h3-6,10H,1,7-8H2,2H3 |
| InChIKey | BKFXVANRLMNOFO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|