C15H15Cl3O5 — CID 163274266
4-O-[(4-methoxyphenyl)methyl] 1-O-(2,2,2-trichloroethyl) 2-methylidenebutanedioate (PubChem CID 163274266) has the molecular formula C15H15Cl3O5 and a molecular weight of 381.64 g/mol. Its IUPAC name is 4-O-[(4-methoxyphenyl)methyl] 1-O-(2,2,2-trichloroethyl) 2-methylidenebutanedioate.
| Compound Name | 4-O-[(4-methoxyphenyl)methyl] 1-O-(2,2,2-trichloroethyl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 163274266 |
| Molecular Formula | C15H15Cl3O5 |
| Molecular Weight | 381.64 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 4-O-[(4-methoxyphenyl)methyl] 1-O-(2,2,2-trichloroethyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCc1ccc(OC)cc1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H15Cl3O5/c1-10(14(20)23-9-15(16,17)18)7-13(19)22-8-11-3-5-12(21-2)6-4-11/h3-6H,1,7-9H2,2H3 |
| InChIKey | MRXHQMAUHJLLRD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|