C11H11F3O2 — CID 135080500
1-methoxy-4-(3,3,3-trifluoroprop-1-en-2-yloxymethyl)benzene (PubChem CID 135080500) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is 1-methoxy-4-(3,3,3-trifluoroprop-1-en-2-yloxymethyl)benzene.
| Compound Name | 1-methoxy-4-(3,3,3-trifluoroprop-1-en-2-yloxymethyl)benzene |
|---|---|
| PubChem CID | 135080500 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-methoxy-4-(3,3,3-trifluoroprop-1-en-2-yloxymethyl)benzene |
| SMILES | C=C(OCc1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-8(11(12,13)14)16-7-9-3-5-10(15-2)6-4-9/h3-6H,1,7H2,2H3 |
| InChIKey | KJTCDXSCTLXHSX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|