C14H15Cl2NO2 — CID 121405286
(1E,3E)-4,5-dichloro-2-[(4-methoxyphenyl)methoxy]hexa-1,3,5-trien-1-amine (PubChem CID 121405286) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is (1E,3E)-4,5-dichloro-2-[(4-methoxyphenyl)methoxy]hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-4,5-dichloro-2-[(4-methoxyphenyl)methoxy]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 121405286 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (1E,3E)-4,5-dichloro-2-[(4-methoxyphenyl)methoxy]hexa-1,3,5-trien-1-amine |
| SMILES | C=C(Cl)/C(Cl)=C\C(=C/N)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H15Cl2NO2/c1-10(15)14(16)7-13(8-17)19-9-11-3-5-12(18-2)6-4-11/h3-8H,1,9,17H2,2H3/b13-8+,14-7+ |
| InChIKey | CXFHWFDXZKOGGI-CCLLZULESA-N |
| XLogP | 3.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|