C19H21Cl3O6 — CID 167047215
4-O-[(4-ethylphenyl)methyl] 1-O-[3-oxo-3-(2,2,2-trichloroethoxy)propyl] 2-methylidenebutanedioate (PubChem CID 167047215) has the molecular formula C19H21Cl3O6 and a molecular weight of 451.73 g/mol. Its IUPAC name is 4-O-[(4-ethylphenyl)methyl] 1-O-[3-oxo-3-(2,2,2-trichloroethoxy)propyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-[(4-ethylphenyl)methyl] 1-O-[3-oxo-3-(2,2,2-trichloroethoxy)propyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 167047215 |
| Molecular Formula | C19H21Cl3O6 |
| Molecular Weight | 451.73 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 4-O-[(4-ethylphenyl)methyl] 1-O-[3-oxo-3-(2,2,2-trichloroethoxy)propyl] 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCc1ccc(CC)cc1)C(=O)OCCC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H21Cl3O6/c1-3-14-4-6-15(7-5-14)11-27-17(24)10-13(2)18(25)26-9-8-16(23)28-12-19(20,21)22/h4-7H,2-3,8-12H2,1H3 |
| InChIKey | CIGQVQLNPBZMFX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|