About ethane;(4-ethylphenyl)methyl carbonofluoridate
ethane;(4-ethylphenyl)methyl carbonofluoridate (PubChem CID 178047310) has the molecular formula C12H17FO2
and a molecular weight of 212.26 g/mol. Its IUPAC name is ethane;(4-ethylphenyl)methyl carbonofluoridate.
Molecular Properties
| Compound Name | ethane;(4-ethylphenyl)methyl carbonofluoridate |
| PubChem CID | 178047310 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethane;(4-ethylphenyl)methyl carbonofluoridate |
| SMILES | CC.CCc1ccc(COC(=O)F)cc1 |
| InChI | InChI=1S/C10H11FO2.C2H6/c1-2-8-3-5-9(6-4-8)7-13-10(11)12;1-2/h3-6H,2,7H2,1H3;1-2H3 |
| InChIKey | HHZYQRQQZBTXFM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-ethylphenyl)methyl carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-ethylphenyl)methyl carbonofluoridate?
The IUPAC name of ethane;(4-ethylphenyl)methyl carbonofluoridate (CID 178047310) is ethane;(4-ethylphenyl)methyl carbonofluoridate.
What is the SMILES notation for ethane;(4-ethylphenyl)methyl carbonofluoridate?
The canonical SMILES for ethane;(4-ethylphenyl)methyl carbonofluoridate is CC.CCc1ccc(COC(=O)F)cc1.
What is the InChIKey of ethane;(4-ethylphenyl)methyl carbonofluoridate?
The InChIKey is HHZYQRQQZBTXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO2.C2H6/c1-2-8-3-5-9(6-4-8)7-13-10(11)12;1-2/h3-6H,2,7H2,1H3;1-2H3.
What are the key properties of ethane;(4-ethylphenyl)methyl carbonofluoridate?
ethane;(4-ethylphenyl)methyl carbonofluoridate has a molecular weight of 212.26 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-ethylphenyl)methyl carbonofluoridate is sourced from PubChem (CID 178047310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).