C16H18N2O2S — CID 134513469
[4-(sulfanylamino)phenyl]methyl N-(4-ethylphenyl)carbamate (PubChem CID 134513469) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is [4-(sulfanylamino)phenyl]methyl N-(4-ethylphenyl)carbamate.
| Compound Name | [4-(sulfanylamino)phenyl]methyl N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 134513469 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [4-(sulfanylamino)phenyl]methyl N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)OCc2ccc(NS)cc2)cc1 |
| InChI | InChI=1S/C16H18N2O2S/c1-2-12-3-7-14(8-4-12)17-16(19)20-11-13-5-9-15(18-21)10-6-13/h3-10,18,21H,2,11H2,1H3,(H,17,19) |
| InChIKey | PIIWPSJVGQJZMO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|