C13H20N2O2 — CID 159970394
(4-ethylphenyl)methyl N-(propan-2-ylamino)carbamate (PubChem CID 159970394) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (4-ethylphenyl)methyl N-(propan-2-ylamino)carbamate.
| Compound Name | (4-ethylphenyl)methyl N-(propan-2-ylamino)carbamate |
|---|---|
| PubChem CID | 159970394 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (4-ethylphenyl)methyl N-(propan-2-ylamino)carbamate |
| SMILES | CCc1ccc(COC(=O)NNC(C)C)cc1 |
| InChI | InChI=1S/C13H20N2O2/c1-4-11-5-7-12(8-6-11)9-17-13(16)15-14-10(2)3/h5-8,10,14H,4,9H2,1-3H3,(H,15,16) |
| InChIKey | RTYDZPBCYVTADA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|