C14H20N2O4 — CID 142149738
(4-ethylphenyl)methyl N-(1-amino-3-hydroxy-2-methyl-1-oxopropan-2-yl)carbamate (PubChem CID 142149738) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (4-ethylphenyl)methyl N-(1-amino-3-hydroxy-2-methyl-1-oxopropan-2-yl)carbamate.
| Compound Name | (4-ethylphenyl)methyl N-(1-amino-3-hydroxy-2-methyl-1-oxopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 142149738 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (4-ethylphenyl)methyl N-(1-amino-3-hydroxy-2-methyl-1-oxopropan-2-yl)carbamate |
| SMILES | CCc1ccc(COC(=O)NC(C)(CO)C(N)=O)cc1 |
| InChI | InChI=1S/C14H20N2O4/c1-3-10-4-6-11(7-5-10)8-20-13(19)16-14(2,9-17)12(15)18/h4-7,17H,3,8-9H2,1-2H3,(H2,15,18)(H,16,19) |
| InChIKey | QIXDBEUOAQOPBQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |