C17H18N2O4 — CID 130458380
[4-[[4-(methylamino)phenyl]methoxycarbonylamino]phenyl]methyl formate (PubChem CID 130458380) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is [4-[[4-(methylamino)phenyl]methoxycarbonylamino]phenyl]methyl formate.
| Compound Name | [4-[[4-(methylamino)phenyl]methoxycarbonylamino]phenyl]methyl formate |
|---|---|
| PubChem CID | 130458380 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [4-[[4-(methylamino)phenyl]methoxycarbonylamino]phenyl]methyl formate |
| SMILES | CNc1ccc(COC(=O)Nc2ccc(COC=O)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-18-15-6-2-14(3-7-15)11-23-17(21)19-16-8-4-13(5-9-16)10-22-12-20/h2-9,12,18H,10-11H2,1H3,(H,19,21) |
| InChIKey | DFCVFTSLYLQFAI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|