C11H15NO2S — CID 139308060
[4-(methylamino)phenyl]methyl 2-sulfanylpropanoate (PubChem CID 139308060) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is [4-(methylamino)phenyl]methyl 2-sulfanylpropanoate.
| Compound Name | [4-(methylamino)phenyl]methyl 2-sulfanylpropanoate |
|---|---|
| PubChem CID | 139308060 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | [4-(methylamino)phenyl]methyl 2-sulfanylpropanoate |
| SMILES | CNc1ccc(COC(=O)C(C)S)cc1 |
| InChI | InChI=1S/C11H15NO2S/c1-8(15)11(13)14-7-9-3-5-10(12-2)6-4-9/h3-6,8,12,15H,7H2,1-2H3 |
| InChIKey | GUDCHAKANCMWPQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|