C16H25N3O4 — CID 171843698
[4-(methylamino)phenyl]methyl N-[2-[ethoxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate (PubChem CID 171843698) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is [4-(methylamino)phenyl]methyl N-[2-[ethoxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate.
| Compound Name | [4-(methylamino)phenyl]methyl N-[2-[ethoxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171843698 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | [4-(methylamino)phenyl]methyl N-[2-[ethoxycarbonyl(methyl)amino]ethyl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)CCN(C)C(=O)OCc1ccc(NC)cc1 |
| InChI | InChI=1S/C16H25N3O4/c1-5-22-15(20)18(3)10-11-19(4)16(21)23-12-13-6-8-14(17-2)9-7-13/h6-9,17H,5,10-12H2,1-4H3 |
| InChIKey | NEQDPABXDKWDCG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |