C17H26N2O3 — CID 178047297
(4-methylphenyl)methyl N-[2-[butanoyl(methyl)amino]ethyl]-N-methylcarbamate (PubChem CID 178047297) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (4-methylphenyl)methyl N-[2-[butanoyl(methyl)amino]ethyl]-N-methylcarbamate.
| Compound Name | (4-methylphenyl)methyl N-[2-[butanoyl(methyl)amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 178047297 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (4-methylphenyl)methyl N-[2-[butanoyl(methyl)amino]ethyl]-N-methylcarbamate |
| SMILES | CCCC(=O)N(C)CCN(C)C(=O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-5-6-16(20)18(3)11-12-19(4)17(21)22-13-15-9-7-14(2)8-10-15/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | VSUKGTCIWKIWEB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |