C23H28N4O5 — CID 166950574
[4-[(3-acetyl-4-hydroxyphenyl)diazenyl]phenyl]methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate (PubChem CID 166950574) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is [4-[(3-acetyl-4-hydroxyphenyl)diazenyl]phenyl]methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate.
| Compound Name | [4-[(3-acetyl-4-hydroxyphenyl)diazenyl]phenyl]methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 166950574 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [4-[(3-acetyl-4-hydroxyphenyl)diazenyl]phenyl]methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate |
| SMILES | CCC(=O)N(C)CCN(C)C(=O)OCc1ccc(/N=N/c2ccc(O)c(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C23H28N4O5/c1-5-22(30)26(3)12-13-27(4)23(31)32-15-17-6-8-18(9-7-17)24-25-19-10-11-21(29)20(14-19)16(2)28/h6-11,14,29H,5,12-13,15H2,1-4H3/b25-24+ |
| InChIKey | REQVLVOUONRGHE-OCOZRVBESA-N |
| XLogP | 4.45 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|