C20H36N2O3 — CID 178047000
ethane;(4-methylphenyl)methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate (PubChem CID 178047000) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is ethane;(4-methylphenyl)methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate.
| Compound Name | ethane;(4-methylphenyl)methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 178047000 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | ethane;(4-methylphenyl)methyl N-methyl-N-[2-[methyl(propanoyl)amino]ethyl]carbamate |
| SMILES | CC.CC.CCC(=O)N(C)CCN(C)C(=O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H24N2O3.2C2H6/c1-5-15(19)17(3)10-11-18(4)16(20)21-12-14-8-6-13(2)7-9-14;2*1-2/h6-9H,5,10-12H2,1-4H3;2*1-2H3 |
| InChIKey | WVFZQTKJOFXACR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |