C13H17I2N3O4 — CID 171843588
iodo N-[2-[[4-(iodoamino)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate (PubChem CID 171843588) has the molecular formula C13H17I2N3O4 and a molecular weight of 533.10 g/mol. Its IUPAC name is iodo N-[2-[[4-(iodoamino)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate.
| Compound Name | iodo N-[2-[[4-(iodoamino)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171843588 |
| Molecular Formula | C13H17I2N3O4 |
| Molecular Weight | 533.10 g/mol |
| Exact Mass | 532.93 |
| IUPAC Name | iodo N-[2-[[4-(iodoamino)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN(C)C(=O)OCc1ccc(NI)cc1)C(=O)OI |
| InChI | InChI=1S/C13H17I2N3O4/c1-17(7-8-18(2)13(20)22-15)12(19)21-9-10-3-5-11(16-14)6-4-10/h3-6,16H,7-9H2,1-2H3 |
| InChIKey | MYVLFHIUMANAPA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|