C23H23N5O3 — CID 136609205
5-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 136609205) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136609205 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 5-[[4-[[4-(diethylamino)phenyl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(/N=N/c3ccc(O)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-3-28(4-2)20-12-9-18(10-13-20)25-24-16-5-7-17(8-6-16)26-27-19-11-14-22(29)21(15-19)23(30)31/h5-15,29H,3-4H2,1-2H3,(H,30,31)/b25-24+,27-26+ |
| InChIKey | ZIKCLASGGLIJBP-JQRDNDPDSA-N |
| XLogP | 6.77 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|