C30H32N2O8 — CID 67893360
2,5-bis[4-(diethylamino)-2-hydroxybenzoyl]terephthalic acid (PubChem CID 67893360) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol. Its IUPAC name is 2,5-bis[4-(diethylamino)-2-hydroxybenzoyl]terephthalic acid.
| Compound Name | 2,5-bis[4-(diethylamino)-2-hydroxybenzoyl]terephthalic acid |
|---|---|
| PubChem CID | 67893360 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 2,5-bis[4-(diethylamino)-2-hydroxybenzoyl]terephthalic acid |
| SMILES | CCN(CC)c1ccc(C(=O)c2cc(C(=O)O)c(C(=O)c3ccc(N(CC)CC)cc3O)cc2C(=O)O)c(O)c1 |
| InChI | InChI=1S/C30H32N2O8/c1-5-31(6-2)17-9-11-19(25(33)13-17)27(35)21-15-24(30(39)40)22(16-23(21)29(37)38)28(36)20-12-10-18(14-26(20)34)32(7-3)8-4/h9-16,33-34H,5-8H2,1-4H3,(H,37,38)(H,39,40) |
| InChIKey | DWUGXNAZAJIJLL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |