C19H19NO6 — CID 23390564
2-[4-[2-carboxyethyl(ethyl)amino]-2-hydroxybenzoyl]benzoic acid (PubChem CID 23390564) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-[4-[2-carboxyethyl(ethyl)amino]-2-hydroxybenzoyl]benzoic acid.
| Compound Name | 2-[4-[2-carboxyethyl(ethyl)amino]-2-hydroxybenzoyl]benzoic acid |
|---|---|
| PubChem CID | 23390564 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[4-[2-carboxyethyl(ethyl)amino]-2-hydroxybenzoyl]benzoic acid |
| SMILES | CCN(CCC(=O)O)c1ccc(C(=O)c2ccccc2C(=O)O)c(O)c1 |
| InChI | InChI=1S/C19H19NO6/c1-2-20(10-9-17(22)23)12-7-8-15(16(21)11-12)18(24)13-5-3-4-6-14(13)19(25)26/h3-8,11,21H,2,9-10H2,1H3,(H,22,23)(H,25,26) |
| InChIKey | BRJXLAXWEYAPCN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |