C26H27NO6 — CID 175238314
benzoic acid;methyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate (PubChem CID 175238314) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is benzoic acid;methyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate.
| Compound Name | benzoic acid;methyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
|---|---|
| PubChem CID | 175238314 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | benzoic acid;methyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccccc2C(=O)OC)c(O)c1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4.C7H6O2/c1-4-20(5-2)13-10-11-16(17(21)12-13)18(22)14-8-6-7-9-15(14)19(23)24-3;8-7(9)6-4-2-1-3-5-6/h6-12,21H,4-5H2,1-3H3;1-5H,(H,8,9) |
| InChIKey | BGJTUMNRMMAJMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |