C22H27NO6 — CID 153448457
2-(2-hydroxyethoxy)ethyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate (PubChem CID 153448457) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
|---|---|
| PubChem CID | 153448457 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccccc2C(=O)OCCOCCO)c(O)c1 |
| InChI | InChI=1S/C22H27NO6/c1-3-23(4-2)16-9-10-19(20(25)15-16)21(26)17-7-5-6-8-18(17)22(27)29-14-13-28-12-11-24/h5-10,15,24-25H,3-4,11-14H2,1-2H3 |
| InChIKey | OGGVHKYPYMKMPS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|