C41H44N2O7 — CID 142905842
[(E)-4-[2-[4-(diethylamino)-2-hydroxybenzoyl]benzoyl]oxybut-2-enyl] 2-[4-(diethylamino)-2-methylbenzoyl]benzoate (PubChem CID 142905842) has the molecular formula C41H44N2O7 and a molecular weight of 676.81 g/mol. Its IUPAC name is [(E)-4-[2-[4-(diethylamino)-2-hydroxybenzoyl]benzoyl]oxybut-2-enyl] 2-[4-(diethylamino)-2-methylbenzoyl]benzoate.
| Compound Name | [(E)-4-[2-[4-(diethylamino)-2-hydroxybenzoyl]benzoyl]oxybut-2-enyl] 2-[4-(diethylamino)-2-methylbenzoyl]benzoate |
|---|---|
| PubChem CID | 142905842 |
| Molecular Formula | C41H44N2O7 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | [(E)-4-[2-[4-(diethylamino)-2-hydroxybenzoyl]benzoyl]oxybut-2-enyl] 2-[4-(diethylamino)-2-methylbenzoyl]benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccccc2C(=O)OC/C=C/COC(=O)c2ccccc2C(=O)c2ccc(N(CC)CC)cc2O)c(C)c1 |
| InChI | InChI=1S/C41H44N2O7/c1-6-42(7-2)29-20-22-31(28(5)26-29)38(45)32-16-10-12-18-34(32)40(47)49-24-14-15-25-50-41(48)35-19-13-11-17-33(35)39(46)36-23-21-30(27-37(36)44)43(8-3)9-4/h10-23,26-27,44H,6-9,24-25H2,1-5H3/b15-14+ |
| InChIKey | AAVKNLONKAVKSG-CCEZHUSRSA-N |
| XLogP | 7.43 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|