About (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate
(3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate (PubChem CID 142944915) has the molecular formula C24H31NO5
and a molecular weight of 413.51 g/mol. Its IUPAC name is (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate.
Molecular Properties
| Compound Name | (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
| PubChem CID | 142944915 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccccc2C(=O)OCC(C)(C)COC)c(O)c1 |
| InChI | InChI=1S/C24H31NO5/c1-6-25(7-2)17-12-13-20(21(26)14-17)22(27)18-10-8-9-11-19(18)23(28)30-16-24(3,4)15-29-5/h8-14,26H,6-7,15-16H2,1-5H3 |
| InChIKey | FFDHZOACODSNLQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate?
The IUPAC name of (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate (CID 142944915) is (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate.
What is the SMILES notation for (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate?
The canonical SMILES for (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate is CCN(CC)c1ccc(C(=O)c2ccccc2C(=O)OCC(C)(C)COC)c(O)c1.
What is the InChIKey of (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate?
The InChIKey is FFDHZOACODSNLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO5/c1-6-25(7-2)17-12-13-20(21(26)14-17)22(27)18-10-8-9-11-19(18)23(28)30-16-24(3,4)15-29-5/h8-14,26H,6-7,15-16H2,1-5H3.
What are the key properties of (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate?
(3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate has a molecular weight of 413.51 g/mol, XLogP of 4.30, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-2,2-dimethylpropyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate is sourced from PubChem (CID 142944915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).