C28H37NO4 — CID 10411533
(5-methyl-2-propan-2-ylcyclohexyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate (PubChem CID 10411533) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
|---|---|
| PubChem CID | 10411533 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccccc2C(=O)OC2CC(C)CCC2C(C)C)c(O)c1 |
| InChI | InChI=1S/C28H37NO4/c1-6-29(7-2)20-13-15-24(25(30)17-20)27(31)22-10-8-9-11-23(22)28(32)33-26-16-19(5)12-14-21(26)18(3)4/h8-11,13,15,17-19,21,26,30H,6-7,12,14,16H2,1-5H3 |
| InChIKey | NUJCOIRNPFQZLR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |