C17H20N4 — CID 140607759
N,N-diethyl-4-[[4-(methylideneamino)phenyl]diazenyl]aniline (PubChem CID 140607759) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-(methylideneamino)phenyl]diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[[4-(methylideneamino)phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 140607759 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N,N-diethyl-4-[[4-(methylideneamino)phenyl]diazenyl]aniline |
| SMILES | C=Nc1ccc(/N=N/c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C17H20N4/c1-4-21(5-2)17-12-10-16(11-13-17)20-19-15-8-6-14(18-3)7-9-15/h6-13H,3-5H2,1-2H3/b20-19+ |
| InChIKey | INBMHTIGCXPFJJ-FMQUCBEESA-N |
| XLogP | 5.28 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|