C16H18F5N3S — CID 122360924
N,N-diethyl-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]aniline (PubChem CID 122360924) has the molecular formula C16H18F5N3S and a molecular weight of 379.40 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 122360924 |
| Molecular Formula | C16H18F5N3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N,N-diethyl-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(S(F)(F)(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H18F5N3S/c1-3-24(4-2)15-9-5-13(6-10-15)22-23-14-7-11-16(12-8-14)25(17,18,19,20)21/h5-12H,3-4H2,1-2H3/b23-22+ |
| InChIKey | HVKGOVZKPPKNET-GHVJWSGMSA-N |
| XLogP | 7.61 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|