C21H22N6 — CID 153313292
N,N-diethyl-4-[[4-(pyridin-4-yldiazenyl)phenyl]diazenyl]aniline (PubChem CID 153313292) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-(pyridin-4-yldiazenyl)phenyl]diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[[4-(pyridin-4-yldiazenyl)phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 153313292 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N,N-diethyl-4-[[4-(pyridin-4-yldiazenyl)phenyl]diazenyl]aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(/N=N/c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C21H22N6/c1-3-27(4-2)21-11-9-19(10-12-21)25-23-17-5-7-18(8-6-17)24-26-20-13-15-22-16-14-20/h5-16H,3-4H2,1-2H3/b25-23+,26-24+ |
| InChIKey | UMNPHIAKPFOEBF-OGGGYYITSA-N |
| XLogP | 6.76 |
| TPSA | 65.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|