C15H18N4O3S — CID 11739136
5-(diethylamino)-2-(pyridin-4-yldiazenyl)benzenesulfonic acid (PubChem CID 11739136) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 5-(diethylamino)-2-(pyridin-4-yldiazenyl)benzenesulfonic acid.
| Compound Name | 5-(diethylamino)-2-(pyridin-4-yldiazenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 11739136 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-(diethylamino)-2-(pyridin-4-yldiazenyl)benzenesulfonic acid |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccncc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C15H18N4O3S/c1-3-19(4-2)13-5-6-14(15(11-13)23(20,21)22)18-17-12-7-9-16-10-8-12/h5-11H,3-4H2,1-2H3,(H,20,21,22)/b18-17+ |
| InChIKey | METHAIFMTJGTIF-ISLYRVAYSA-N |
| XLogP | 3.59 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|