C16H16F3N5O — CID 20728771
1-[5-(diethylamino)-2-(pyrimidin-2-yldiazenyl)phenyl]-2,2,2-trifluoroethanone (PubChem CID 20728771) has the molecular formula C16H16F3N5O and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-[5-(diethylamino)-2-(pyrimidin-2-yldiazenyl)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-(diethylamino)-2-(pyrimidin-2-yldiazenyl)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 20728771 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-[5-(diethylamino)-2-(pyrimidin-2-yldiazenyl)phenyl]-2,2,2-trifluoroethanone |
| SMILES | CCN(CC)c1ccc(/N=N/c2ncccn2)c(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3N5O/c1-3-24(4-2)11-6-7-13(12(10-11)14(25)16(17,18)19)22-23-15-20-8-5-9-21-15/h5-10H,3-4H2,1-2H3/b23-22+ |
| InChIKey | NXOAYFWXVXQRNL-GHVJWSGMSA-N |
| XLogP | 4.48 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|