C28H28F3N7O2S3 — CID 20823496
4-[[4,6-bis[(2-methylphenyl)sulfanyl]-1,3,5-triazin-2-yl]diazenyl]-1-N,1-N-diethyl-3-N-(trifluoromethylperoxysulfanyl)benzene-1,3-diamine (PubChem CID 20823496) has the molecular formula C28H28F3N7O2S3 and a molecular weight of 647.77 g/mol. Its IUPAC name is 4-[[4,6-bis[(2-methylphenyl)sulfanyl]-1,3,5-triazin-2-yl]diazenyl]-1-N,1-N-diethyl-3-N-(trifluoromethylperoxysulfanyl)benzene-1,3-diamine.
| Compound Name | 4-[[4,6-bis[(2-methylphenyl)sulfanyl]-1,3,5-triazin-2-yl]diazenyl]-1-N,1-N-diethyl-3-N-(trifluoromethylperoxysulfanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 20823496 |
| Molecular Formula | C28H28F3N7O2S3 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | 4-[[4,6-bis[(2-methylphenyl)sulfanyl]-1,3,5-triazin-2-yl]diazenyl]-1-N,1-N-diethyl-3-N-(trifluoromethylperoxysulfanyl)benzene-1,3-diamine |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc(Sc3ccccc3C)nc(Sc3ccccc3C)n2)c(NSOOC(F)(F)F)c1 |
| InChI | InChI=1S/C28H28F3N7O2S3/c1-5-38(6-2)20-15-16-21(22(17-20)37-43-40-39-28(29,30)31)35-36-25-32-26(41-23-13-9-7-11-18(23)3)34-27(33-25)42-24-14-10-8-12-19(24)4/h7-17,37H,5-6H2,1-4H3/b36-35+ |
| InChIKey | OSMDZDWQYMYJFX-ULDVOPSXSA-N |
| XLogP | 9.50 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|