C32H31N7O3 — CID 20726419
4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)diazenyl]-1-N,1-N-diethyl-3-N-(phenoxymethyl)benzene-1,3-diamine (PubChem CID 20726419) has the molecular formula C32H31N7O3 and a molecular weight of 561.65 g/mol. Its IUPAC name is 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)diazenyl]-1-N,1-N-diethyl-3-N-(phenoxymethyl)benzene-1,3-diamine.
| Compound Name | 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)diazenyl]-1-N,1-N-diethyl-3-N-(phenoxymethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 20726419 |
| Molecular Formula | C32H31N7O3 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)diazenyl]-1-N,1-N-diethyl-3-N-(phenoxymethyl)benzene-1,3-diamine |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)c(NCOc2ccccc2)c1 |
| InChI | InChI=1S/C32H31N7O3/c1-3-39(4-2)24-20-21-28(29(22-24)33-23-40-25-14-8-5-9-15-25)37-38-30-34-31(41-26-16-10-6-11-17-26)36-32(35-30)42-27-18-12-7-13-19-27/h5-22,33H,3-4,23H2,1-2H3/b38-37+ |
| InChIKey | PILSSVXIYUAOHC-HEFFKOSUSA-N |
| XLogP | 8.17 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|