C35H37N7O2S3 — CID 59943111
2-[[4-(diethylamino)-2-(phenoxysulfinylamino)phenyl]diazenyl]-4,6-bis[(2,6-dimethylphenyl)sulfanyl]-1,3,5-triazine (PubChem CID 59943111) has the molecular formula C35H37N7O2S3 and a molecular weight of 683.93 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-2-(phenoxysulfinylamino)phenyl]diazenyl]-4,6-bis[(2,6-dimethylphenyl)sulfanyl]-1,3,5-triazine.
| Compound Name | 2-[[4-(diethylamino)-2-(phenoxysulfinylamino)phenyl]diazenyl]-4,6-bis[(2,6-dimethylphenyl)sulfanyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 59943111 |
| Molecular Formula | C35H37N7O2S3 |
| Molecular Weight | 683.93 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | 2-[[4-(diethylamino)-2-(phenoxysulfinylamino)phenyl]diazenyl]-4,6-bis[(2,6-dimethylphenyl)sulfanyl]-1,3,5-triazine |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc(Sc3c(C)cccc3C)nc(Sc3c(C)cccc3C)n2)c(NS(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C35H37N7O2S3/c1-7-42(8-2)27-20-21-29(30(22-27)41-47(43)44-28-18-10-9-11-19-28)39-40-33-36-34(45-31-23(3)14-12-15-24(31)4)38-35(37-33)46-32-25(5)16-13-17-26(32)6/h9-22,41H,7-8H2,1-6H3/b40-39+ |
| InChIKey | MKNOTJWIWFAEDJ-XQQUEIPISA-N |
| XLogP | 9.74 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.93 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|