C29H41N7O4S — CID 20581949
2-[[4-(diethylamino)-2-[(4-ethylphenoxy)sulfinylamino]phenyl]diazenyl]-4,6-bis[(2-methylpropan-2-yl)oxy]-1,3,5-triazine (PubChem CID 20581949) has the molecular formula C29H41N7O4S and a molecular weight of 583.76 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-2-[(4-ethylphenoxy)sulfinylamino]phenyl]diazenyl]-4,6-bis[(2-methylpropan-2-yl)oxy]-1,3,5-triazine.
| Compound Name | 2-[[4-(diethylamino)-2-[(4-ethylphenoxy)sulfinylamino]phenyl]diazenyl]-4,6-bis[(2-methylpropan-2-yl)oxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 20581949 |
| Molecular Formula | C29H41N7O4S |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 2-[[4-(diethylamino)-2-[(4-ethylphenoxy)sulfinylamino]phenyl]diazenyl]-4,6-bis[(2-methylpropan-2-yl)oxy]-1,3,5-triazine |
| SMILES | CCc1ccc(OS(=O)Nc2cc(N(CC)CC)ccc2/N=N/c2nc(OC(C)(C)C)nc(OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C29H41N7O4S/c1-10-20-13-16-22(17-14-20)40-41(37)35-24-19-21(36(11-2)12-3)15-18-23(24)33-34-25-30-26(38-28(4,5)6)32-27(31-25)39-29(7,8)9/h13-19,35H,10-12H2,1-9H3/b34-33+ |
| InChIKey | AXDNZJBEPMESFG-JEIPZWNWSA-N |
| XLogP | 7.12 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|