C20H21ClN8O3 — CID 102149168
3-N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-1-N,1-N-diethyl-4-[(4-nitrophenyl)diazenyl]benzene-1,3-diamine (PubChem CID 102149168) has the molecular formula C20H21ClN8O3 and a molecular weight of 456.89 g/mol. Its IUPAC name is 3-N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-1-N,1-N-diethyl-4-[(4-nitrophenyl)diazenyl]benzene-1,3-diamine.
| Compound Name | 3-N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-1-N,1-N-diethyl-4-[(4-nitrophenyl)diazenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 102149168 |
| Molecular Formula | C20H21ClN8O3 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 3-N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-1-N,1-N-diethyl-4-[(4-nitrophenyl)diazenyl]benzene-1,3-diamine |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)c(Nc2nc(Cl)nc(OC)n2)c1 |
| InChI | InChI=1S/C20H21ClN8O3/c1-4-28(5-2)15-10-11-16(27-26-13-6-8-14(9-7-13)29(30)31)17(12-15)22-19-23-18(21)24-20(25-19)32-3/h6-12H,4-5H2,1-3H3,(H,22,23,24,25)/b27-26+ |
| InChIKey | OQXXXRUKVFFICP-CYYJNZCTSA-N |
| XLogP | 5.45 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|