C28H28FN5O3 — CID 148992014
N,N-diethyl-5-[5-(ethylamino)-4-fluoro-2-[(4-nitrophenyl)diazenyl]phenoxy]naphthalen-2-amine (PubChem CID 148992014) has the molecular formula C28H28FN5O3 and a molecular weight of 501.56 g/mol. Its IUPAC name is N,N-diethyl-5-[5-(ethylamino)-4-fluoro-2-[(4-nitrophenyl)diazenyl]phenoxy]naphthalen-2-amine.
| Compound Name | N,N-diethyl-5-[5-(ethylamino)-4-fluoro-2-[(4-nitrophenyl)diazenyl]phenoxy]naphthalen-2-amine |
|---|---|
| PubChem CID | 148992014 |
| Molecular Formula | C28H28FN5O3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N,N-diethyl-5-[5-(ethylamino)-4-fluoro-2-[(4-nitrophenyl)diazenyl]phenoxy]naphthalen-2-amine |
| SMILES | CCNc1cc(Oc2cccc3cc(N(CC)CC)ccc23)c(/N=N/c2ccc([N+](=O)[O-])cc2)cc1F |
| InChI | InChI=1S/C28H28FN5O3/c1-4-30-25-18-28(26(17-24(25)29)32-31-20-10-12-21(13-11-20)34(35)36)37-27-9-7-8-19-16-22(14-15-23(19)27)33(5-2)6-3/h7-18,30H,4-6H2,1-3H3/b32-31+ |
| InChIKey | PXWWDTSLCKFVCC-QNEJGDQOSA-N |
| XLogP | 8.37 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|