C28H26N4O3 — CID 175120099
[6-(5,6-diethylnaphthalen-1-yl)oxy-2,3-dihydro-1H-indol-5-yl]-(4-nitrophenyl)diazene (PubChem CID 175120099) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is [6-(5,6-diethylnaphthalen-1-yl)oxy-2,3-dihydro-1H-indol-5-yl]-(4-nitrophenyl)diazene.
| Compound Name | [6-(5,6-diethylnaphthalen-1-yl)oxy-2,3-dihydro-1H-indol-5-yl]-(4-nitrophenyl)diazene |
|---|---|
| PubChem CID | 175120099 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [6-(5,6-diethylnaphthalen-1-yl)oxy-2,3-dihydro-1H-indol-5-yl]-(4-nitrophenyl)diazene |
| SMILES | CCc1ccc2c(Oc3cc4c(cc3/N=N\c3ccc([N+](=O)[O-])cc3)CCN4)cccc2c1CC |
| InChI | InChI=1S/C28H26N4O3/c1-3-18-8-13-24-23(22(18)4-2)6-5-7-27(24)35-28-17-25-19(14-15-29-25)16-26(28)31-30-20-9-11-21(12-10-20)32(33)34/h5-13,16-17,29H,3-4,14-15H2,1-2H3/b31-30- |
| InChIKey | ZKLMAJGUYHRFJA-KTMFPKCZSA-N |
| XLogP | 8.05 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|