C16H10Cl3N7O3 — CID 132523379
4,6-dichloro-N-[4-[(2-chloro-4-nitrophenyl)diazenyl]-3-methoxyphenyl]-1,3,5-triazin-2-amine (PubChem CID 132523379) has the molecular formula C16H10Cl3N7O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is 4,6-dichloro-N-[4-[(2-chloro-4-nitrophenyl)diazenyl]-3-methoxyphenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-[4-[(2-chloro-4-nitrophenyl)diazenyl]-3-methoxyphenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 132523379 |
| Molecular Formula | C16H10Cl3N7O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 4,6-dichloro-N-[4-[(2-chloro-4-nitrophenyl)diazenyl]-3-methoxyphenyl]-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2nc(Cl)nc(Cl)n2)ccc1/N=N/c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H10Cl3N7O3/c1-29-13-6-8(20-16-22-14(18)21-15(19)23-16)2-4-12(13)25-24-11-5-3-9(26(27)28)7-10(11)17/h2-7H,1H3,(H,20,21,22,23)/b25-24+ |
| InChIKey | DUSCLTFLZOUKKL-OCOZRVBESA-N |
| XLogP | 5.91 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|