C16H12ClN5O2 — CID 86176201
4-chloro-6-(4-methylphenyl)-N-(4-nitrophenyl)-1,3,5-triazin-2-amine (PubChem CID 86176201) has the molecular formula C16H12ClN5O2 and a molecular weight of 341.76 g/mol. Its IUPAC name is 4-chloro-6-(4-methylphenyl)-N-(4-nitrophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(4-methylphenyl)-N-(4-nitrophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 86176201 |
| Molecular Formula | C16H12ClN5O2 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-chloro-6-(4-methylphenyl)-N-(4-nitrophenyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(-c2nc(Cl)nc(Nc3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C16H12ClN5O2/c1-10-2-4-11(5-3-10)14-19-15(17)21-16(20-14)18-12-6-8-13(9-7-12)22(23)24/h2-9H,1H3,(H,18,19,20,21) |
| InChIKey | SMSUYEAYJWRVOQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|