C27H21N5O4 — CID 6163011
N-(4-methylphenyl)-4,6-bis[(E)-2-(3-nitrophenyl)ethenyl]pyrimidin-2-amine (PubChem CID 6163011) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-(4-methylphenyl)-4,6-bis[(E)-2-(3-nitrophenyl)ethenyl]pyrimidin-2-amine.
| Compound Name | N-(4-methylphenyl)-4,6-bis[(E)-2-(3-nitrophenyl)ethenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 6163011 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-(4-methylphenyl)-4,6-bis[(E)-2-(3-nitrophenyl)ethenyl]pyrimidin-2-amine |
| SMILES | Cc1ccc(Nc2nc(/C=C/c3cccc([N+](=O)[O-])c3)cc(/C=C/c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C27H21N5O4/c1-19-8-12-22(13-9-19)28-27-29-23(14-10-20-4-2-6-25(16-20)31(33)34)18-24(30-27)15-11-21-5-3-7-26(17-21)32(35)36/h2-18H,1H3,(H,28,29,30)/b14-10+,15-11+ |
| InChIKey | XGAPATJRIJZGSQ-WFYKWJGLSA-N |
| XLogP | 6.69 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|