C18H16N6O4 — CID 7614619
[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-nitrobenzoate (PubChem CID 7614619) has the molecular formula C18H16N6O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-nitrobenzoate.
| Compound Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-nitrobenzoate |
|---|---|
| PubChem CID | 7614619 |
| Molecular Formula | C18H16N6O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-nitrobenzoate |
| SMILES | Cc1ccc(Nc2nc(N)nc(COC(=O)c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C18H16N6O4/c1-11-5-7-13(8-6-11)20-18-22-15(21-17(19)23-18)10-28-16(25)12-3-2-4-14(9-12)24(26)27/h2-9H,10H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | UBRQNQFNUUFDDY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 146.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|