C17H13ClN6O4 — CID 7593618
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 5-chloro-2-nitrobenzoate (PubChem CID 7593618) has the molecular formula C17H13ClN6O4 and a molecular weight of 400.78 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 5-chloro-2-nitrobenzoate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 7593618 |
| Molecular Formula | C17H13ClN6O4 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 5-chloro-2-nitrobenzoate |
| SMILES | Nc1nc(COC(=O)c2cc(Cl)ccc2[N+](=O)[O-])nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H13ClN6O4/c18-10-6-7-13(24(26)27)12(8-10)15(25)28-9-14-21-16(19)23-17(22-14)20-11-4-2-1-3-5-11/h1-8H,9H2,(H3,19,20,21,22,23) |
| InChIKey | YGMUOTVAKSISJI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 146.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|