C18H16N6O5 — CID 26971082
methyl 4-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methoxy]-3-nitrobenzoate (PubChem CID 26971082) has the molecular formula C18H16N6O5 and a molecular weight of 396.36 g/mol. Its IUPAC name is methyl 4-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 26971082 |
| Molecular Formula | C18H16N6O5 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | methyl 4-[(4-amino-6-anilino-1,3,5-triazin-2-yl)methoxy]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(OCc2nc(N)nc(Nc3ccccc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N6O5/c1-28-16(25)11-7-8-14(13(9-11)24(26)27)29-10-15-21-17(19)23-18(22-15)20-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | SFLCAHCYSBRXPX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|