C17H16N4O5 — CID 55374668
methyl 4-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methoxy]-3-nitrobenzoate (PubChem CID 55374668) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is methyl 4-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 55374668 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | methyl 4-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methoxy]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(OCc2cn3c(C)cc(C)nc3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O5/c1-10-6-11(2)20-8-13(19-17(20)18-10)9-26-15-5-4-12(16(22)25-3)7-14(15)21(23)24/h4-8H,9H2,1-3H3 |
| InChIKey | QVUCAXXDLCANFM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|