C20H17N5O6 — CID 36642499
methyl 4-[(4-ethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methoxy]-3-nitrobenzoate (PubChem CID 36642499) has the molecular formula C20H17N5O6 and a molecular weight of 423.39 g/mol. Its IUPAC name is methyl 4-[(4-ethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[(4-ethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 36642499 |
| Molecular Formula | C20H17N5O6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | methyl 4-[(4-ethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methoxy]-3-nitrobenzoate |
| SMILES | CCn1c(=O)c2ccccc2n2c(COc3ccc(C(=O)OC)cc3[N+](=O)[O-])nnc12 |
| InChI | InChI=1S/C20H17N5O6/c1-3-23-18(26)13-6-4-5-7-14(13)24-17(21-22-20(23)24)11-31-16-9-8-12(19(27)30-2)10-15(16)25(28)29/h4-10H,3,11H2,1-2H3 |
| InChIKey | QLOIQEDDTOGPDG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 130.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|