C17H16N4O6 — CID 71848319
methyl 4-[(4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methoxy]-3-nitrobenzoate (PubChem CID 71848319) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is methyl 4-[(4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[(4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 71848319 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl 4-[(4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methoxy]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(OCc2nc(N)c3c(C)c(C)oc3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O6/c1-8-9(2)27-16-14(8)15(18)19-13(20-16)7-26-12-5-4-10(17(22)25-3)6-11(12)21(23)24/h4-6H,7H2,1-3H3,(H2,18,19,20) |
| InChIKey | BVCJWGCQQAXCJN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|