C17H14IN5O2 — CID 28559006
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-iodobenzoate (PubChem CID 28559006) has the molecular formula C17H14IN5O2 and a molecular weight of 447.24 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-iodobenzoate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-iodobenzoate |
|---|---|
| PubChem CID | 28559006 |
| Molecular Formula | C17H14IN5O2 |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-iodobenzoate |
| SMILES | Nc1nc(COC(=O)c2ccc(I)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H14IN5O2/c18-12-8-6-11(7-9-12)15(24)25-10-14-21-16(19)23-17(22-14)20-13-4-2-1-3-5-13/h1-9H,10H2,(H3,19,20,21,22,23) |
| InChIKey | XUJKYJBASSSBRG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|