C22H23N5O4 — CID 46821610
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 46821610) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 46821610 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | Nc1nc(COC(=O)c2ccc(OCC3CCCO3)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C22H23N5O4/c23-21-25-19(26-22(27-21)24-16-5-2-1-3-6-16)14-31-20(28)15-8-10-17(11-9-15)30-13-18-7-4-12-29-18/h1-3,5-6,8-11,18H,4,7,12-14H2,(H3,23,24,25,26,27) |
| InChIKey | MWVBPNVSTGHVKG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |