C10H11N5O — CID 117058513
(4-amino-6-anilino-1,3,5-triazin-2-yl)methanol (PubChem CID 117058513) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methanol.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methanol |
|---|---|
| PubChem CID | 117058513 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methanol |
| SMILES | Nc1nc(CO)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C10H11N5O/c11-9-13-8(6-16)14-10(15-9)12-7-4-2-1-3-5-7/h1-5,16H,6H2,(H3,11,12,13,14,15) |
| InChIKey | XLACMPMLSZWIAM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |