C9H13N6O4P — CID 162156897
2-N-phenyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid (PubChem CID 162156897) has the molecular formula C9H13N6O4P and a molecular weight of 300.22 g/mol. Its IUPAC name is 2-N-phenyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid.
| Compound Name | 2-N-phenyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid |
|---|---|
| PubChem CID | 162156897 |
| Molecular Formula | C9H13N6O4P |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-N-phenyl-1,3,5-triazine-2,4,6-triamine;phosphoric acid |
| SMILES | Nc1nc(N)nc(Nc2ccccc2)n1.O=P(O)(O)O |
| InChI | InChI=1S/C9H10N6.H3O4P/c10-7-13-8(11)15-9(14-7)12-6-4-2-1-3-5-6;1-5(2,3)4/h1-5H,(H5,10,11,12,13,14,15);(H3,1,2,3,4) |
| InChIKey | ZLYHDYSDLNKZMU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 180.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|